Compound Q&A

How is 7-Methoxy-1H-indole-3-carboxylic acid (CAS: 128717-77-1) typically synthesized?

Answer

7-Methoxy-1H-indole-3-carboxylic acid
7-Methoxy-1H-indole-3-carboxylic acid can be synthesized via the condensation of 7-methoxyindole with trichloroacetyl chloride in the presence of a catalyst like 4-Acetamidobenzene or 4-acetamidobenzoyl chloride. The reaction yields a mixture of isomers, with the desired product being separated by column chromatography.

About

English Name 7-Methoxy-1H-indole-3-carboxylic acid
Molecular Formula C10H9NO3
Molecular Weight 191.19 g/mol
SMILES COC1=CC=CC2=C1NC=C2C(=O)O
InChIKey MSALXMDIYCKASR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Methoxy-1H-indole-3-carboxylic acid (CAS: 128717-77-1)?

7-Methoxy-1H-indole-3-carboxylic acid is a white or off-white crystalline solid with a molecular wei...

Compound Q&A

What industries use 7-Methoxy-1H-indole-3-carboxylic acid (CAS: 128717-77-1)?

7-Methoxy-1H-indole-3-carboxylic acid is used in the pharmaceutical industry as a precursor to synth...

Compound Q&A

What precautions should be taken when handling 7-Methoxy-1H-indole-3-carboxylic acid (CAS: 128717-77-1)?

When handling 7-Methoxy-1H-indole-3-carboxylic acid, ensure use of personal protective equipment suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...