Compound Q&A

What are the physical and chemical properties of 7-Methoxy-1H-indole-3-carboxylic acid (CAS: 128717-77-1)?

Answer

7-Methoxy-1H-indole-3-carboxylic acid
7-Methoxy-1H-indole-3-carboxylic acid is a white or off-white crystalline solid with a molecular weight of 217.22 g/mol. It has a slight pungent odor and is poorly soluble in water but soluble in organic solvents like methanol and ethanol. It is moderately reactive towards bases and can form salts. It does not react with acids under normal conditions.

About

English Name 7-Methoxy-1H-indole-3-carboxylic acid
Molecular Formula C10H9NO3
Molecular Weight 191.19 g/mol
SMILES COC1=CC=CC2=C1NC=C2C(=O)O
InChIKey MSALXMDIYCKASR-UHFFFAOYSA-N
Last Updated: 2025-10-26 09:38

Related Q&A

Compound Q&A

How is 7-Methoxy-1H-indole-3-carboxylic acid (CAS: 128717-77-1) typically synthesized?

7-Methoxy-1H-indole-3-carboxylic acid can be synthesized via the condensation of 7-methoxyindole wit...

Compound Q&A

What industries use 7-Methoxy-1H-indole-3-carboxylic acid (CAS: 128717-77-1)?

7-Methoxy-1H-indole-3-carboxylic acid is used in the pharmaceutical industry as a precursor to synth...

Compound Q&A

What precautions should be taken when handling 7-Methoxy-1H-indole-3-carboxylic acid (CAS: 128717-77-1)?

When handling 7-Methoxy-1H-indole-3-carboxylic acid, ensure use of personal protective equipment suc...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...