Compound Q&A

What industries use Fluvastatin methyl ester (CAS: 93957-53-0)?

Answer

Fluvastatin methyl ester
Fluvastatin methyl ester (CAS: 93957-53-0) is primarily used in the pharmaceutical industry for the production of statins. It is also used in the research and development of cholesterol-lowering drugs. Additionally, due to its structural similarity to other statins, it may have applications in the polymer and sensor industries.

About

CAS No 93957-53-0
English Name Fluvastatin methyl ester
Molecular Formula C25H28FNO4
Molecular Weight 425.5 g/mol
SMILES CC(C)N1C2=CC=CC=C2C(=C1C=CC(CC(CC(=O)OC)O)O)C3=CC=C(C=C3)F
InChIKey BOCZYIUKFAQNLG-DSJWGCTQSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fluvastatin methyl ester (CAS: 93957-53-0)?

Fluvastatin methyl ester (CAS: 93957-53-0) is a white to off-white crystalline powder with a molecul...

Compound Q&A

How is Fluvastatin methyl ester (CAS: 93957-53-0) typically synthesized?

Fluvastatin methyl ester (CAS: 93957-53-0) is typically synthesized through a multi-step process inv...

Compound Q&A

What precautions should be taken when handling Fluvastatin methyl ester (CAS: 93957-53-0)?

When handling Fluvastatin methyl ester (CAS: 93957-53-0), it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...