Compound Q&A

What are the physical and chemical properties of Fluvastatin methyl ester (CAS: 93957-53-0)?

Answer

Fluvastatin methyl ester
Fluvastatin methyl ester (CAS: 93957-53-0) is a white to off-white crystalline powder with a molecular weight of approximately 338.4 g/mol. It has a low water solubility and is soluble in organic solvents like methanol and ethanol. This compound is relatively stable but can react with strong bases and is prone to hydrolysis under basic conditions. It is used in the synthesis of statins and has potential applications in pharmaceuticals.

About

CAS No 93957-53-0
English Name Fluvastatin methyl ester
Molecular Formula C25H28FNO4
Molecular Weight 425.5 g/mol
SMILES CC(C)N1C2=CC=CC=C2C(=C1C=CC(CC(CC(=O)OC)O)O)C3=CC=C(C=C3)F
InChIKey BOCZYIUKFAQNLG-DSJWGCTQSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is Fluvastatin methyl ester (CAS: 93957-53-0) typically synthesized?

Fluvastatin methyl ester (CAS: 93957-53-0) is typically synthesized through a multi-step process inv...

Compound Q&A

What industries use Fluvastatin methyl ester (CAS: 93957-53-0)?

Fluvastatin methyl ester (CAS: 93957-53-0) is primarily used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling Fluvastatin methyl ester (CAS: 93957-53-0)?

When handling Fluvastatin methyl ester (CAS: 93957-53-0), it is essential to wear appropriate person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...