Compound Q&A

What precautions should be taken when handling Lamotrigine EP Impurity B and Lamotrigine EP Impurity C (CAS: 84689-20-3)?

Answer

Lamotrigine EP Impurity B and Lamotrigine EP Impurity C
When handling Lamotrigine EP Impurity B and C (CAS: 84689-20-3), it is essential to use appropriate personal protective equipment (PPE) such as gloves and safety glasses. Work should be conducted in a well-ventilated area or a fume hood to prevent inhalation. Spills should be cleaned up using appropriate absorbent materials, and the area should be properly decontaminated. Always consult the Safety Data Sheet (SDS) for detailed handling and emergency procedures. Storage should be in a cool, dry place, away from direct sunlight.

About

CAS No 84689-20-3
English Name Lamotrigine EP Impurity B and Lamotrigine EP Impurity C
Molecular Formula C9H7Cl2N5
Molecular Weight 256.09 g/mol
SMILES NC(=N)NN=C(c1cccc(c1Cl)Cl)C#N
InChIKey MLWONQDCGJOILV-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Lamotrigine EP Impurity B and Lamotrigine EP Impurity C (CAS: 84689-20-3)?

Lamotrigine EP Impurity B and C are impurities found in the lamotrigine drug substance. They are whi...

Compound Q&A

How are Lamotrigine EP Impurity B and Lamotrigine EP Impurity C (CAS: 84689-20-3) typically synthesized?

Lamotrigine EP Impurity B and C are typically synthesized as by-products during the production of la...

Compound Q&A

What industries use Lamotrigine EP Impurity B and Lamotrigine EP Impurity C (CAS: 84689-20-3)?

Lamotrigine EP Impurity B and C are primarily used in the pharmaceutical industry. They are critical...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...