Compound Q&A

What industries use 2-Chloro-4-nitro-1-(trifluoromethyl)benzene (CAS: 151504-80-2)?

Answer

2-Chloro-4-nitro-1-(trifluoromethyl)benzene
2-Chloro-4-nitro-1-(trifluoromethyl)benzene is used in the pharmaceutical industry as an intermediate for the synthesis of certain drugs. It also finds applications in polymer manufacturing, where its unique properties contribute to the development of advanced materials. Additionally, it is utilized in the production of sensors and semiconductors due to its electronic and structural characteristics.

About

English Name 2-Chloro-4-nitro-1-(trifluoromethyl)benzene
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])Cl)C(F)(F)F
InChIKey MOTWHSMEZCFDOD-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-nitro-1-(trifluoromethyl)benzene (CAS: 151504-80-2)?

2-Chloro-4-nitro-1-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of approx...

Compound Q&A

How is 2-Chloro-4-nitro-1-(trifluoromethyl)benzene (CAS: 151504-80-2) typically synthesized?

2-Chloro-4-nitro-1-(trifluoromethyl)benzene is typically synthesized via the nitration of 2-chloro-1...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-nitro-1-(trifluoromethyl)benzene (CAS: 151504-80-2)?

When handling 2-Chloro-4-nitro-1-(trifluoromethyl)benzene, it is essential to use personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...