Compound Q&A

What are the physical and chemical properties of 2-Chloro-4-nitro-1-(trifluoromethyl)benzene (CAS: 151504-80-2)?

Answer

2-Chloro-4-nitro-1-(trifluoromethyl)benzene
2-Chloro-4-nitro-1-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of approximately 266.01 g/mol. It is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. This compound is known for its high reactivity, particularly towards nucleophilic substitution and electrophilic aromatic substitution reactions.

About

English Name 2-Chloro-4-nitro-1-(trifluoromethyl)benzene
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=CC(=C(C=C1[N+](=O)[O-])Cl)C(F)(F)F
InChIKey MOTWHSMEZCFDOD-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 2-Chloro-4-nitro-1-(trifluoromethyl)benzene (CAS: 151504-80-2) typically synthesized?

2-Chloro-4-nitro-1-(trifluoromethyl)benzene is typically synthesized via the nitration of 2-chloro-1...

Compound Q&A

What industries use 2-Chloro-4-nitro-1-(trifluoromethyl)benzene (CAS: 151504-80-2)?

2-Chloro-4-nitro-1-(trifluoromethyl)benzene is used in the pharmaceutical industry as an intermediat...

Compound Q&A

What precautions should be taken when handling 2-Chloro-4-nitro-1-(trifluoromethyl)benzene (CAS: 151504-80-2)?

When handling 2-Chloro-4-nitro-1-(trifluoromethyl)benzene, it is essential to use personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...