Compound Q&A

What are the physical and chemical properties of 5-(Benzyloxy)-2-bromopyridine (CAS: 630120-99-9)?

Answer

5-(Benzyloxy)-2-bromopyridine
5-(Benzyloxy)-2-bromopyridine is a crystalline solid with a molecular weight of approximately 286.03 g/mol. It has a solubility of about 0.1 g/L in water and is slightly soluble in common organic solvents like ethanol and acetone. This compound is reactive towards nucleophiles and is prone to substitution reactions. It is used in synthetic organic chemistry as a starting material and intermediate.

About

English Name 5-(Benzyloxy)-2-bromopyridine
Molecular Formula C12H10BrNO
Molecular Weight 264.12 g/mol
SMILES C1=CC=C(C=C1)COC2=CN=C(C=C2)Br
InChIKey KKCMCYRLJVVNTQ-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 5-(Benzyloxy)-2-bromopyridine (CAS: 630120-99-9) typically synthesized?

5-(Benzyloxy)-2-bromopyridine is typically synthesized through a multi-step process involving the pr...

Compound Q&A

What industries use 5-(Benzyloxy)-2-bromopyridine (CAS: 630120-99-9)?

5-(Benzyloxy)-2-bromopyridine is primarily used in the pharmaceutical and chemical industries as an ...

Compound Q&A

What precautions should be taken when handling 5-(Benzyloxy)-2-bromopyridine (CAS: 630120-99-9)?

Proper personal protective equipment (PPE) including gloves, goggles, and a lab coat should be worn ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...