Compound Q&A

What industries use Disodium 2'-deoxy-5'-O-phosphonatoinosine (CAS: 14999-52-1)?

Answer

Disodium 2'-deoxy-5'-O-phosphonatoinosine
Disodium 2'-deoxy-5'-O-phosphonatoinosine is primarily used in the pharmaceutical industry for the development of antiviral drugs. It is also applied in the polymer industry for synthesizing novel polymeric materials with specific properties. Additionally, it is used in the production of sensors and semiconductors for their unique biological recognition capabilities.

About

CAS No 14999-52-1
English Name Disodium 2'-deoxy-5'-O-phosphonatoinosine
Molecular Formula C10H11N4Na2O7P
Molecular Weight 376.17 g/mol
SMILES C1C(C(OC1N2C=NC3=C2N=CNC3=O)COP(=O)([O-])[O-])O.[Na+].[Na+]
InChIKey VDPLPYMIJCLJEF-OJSHLMAWSA-L
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium 2'-deoxy-5'-O-phosphonatoinosine (CAS: 14999-52-1)?

Disodium 2'-deoxy-5'-O-phosphonatoinosine is a white crystalline solid with a molecular weight of ap...

Compound Q&A

How is Disodium 2'-deoxy-5'-O-phosphonatoinosine (CAS: 14999-52-1) typically synthesized?

Disodium 2'-deoxy-5'-O-phosphonatoinosine is typically synthesized through the condensation of 2'-de...

Compound Q&A

What precautions should be taken when handling Disodium 2'-deoxy-5'-O-phosphonatoinosine (CAS: 14999-52-1)?

When handling Disodium 2'-deoxy-5'-O-phosphonatoinosine, it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...