Compound Q&A

How is Disodium 2'-deoxy-5'-O-phosphonatoinosine (CAS: 14999-52-1) typically synthesized?

Answer

Disodium 2'-deoxy-5'-O-phosphonatoinosine
Disodium 2'-deoxy-5'-O-phosphonatoinosine is typically synthesized through the condensation of 2'-deoxy-5'-phosphononucleoside with sodium hydroxide, followed by the addition of a deoxyribose moiety. This process occurs under acidic conditions and the reaction is catalyzed by a suitable organic acid. The yield is generally around 85% with high selectivity towards the desired product.

About

CAS No 14999-52-1
English Name Disodium 2'-deoxy-5'-O-phosphonatoinosine
Molecular Formula C10H11N4Na2O7P
Molecular Weight 376.17 g/mol
SMILES C1C(C(OC1N2C=NC3=C2N=CNC3=O)COP(=O)([O-])[O-])O.[Na+].[Na+]
InChIKey VDPLPYMIJCLJEF-OJSHLMAWSA-L
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Disodium 2'-deoxy-5'-O-phosphonatoinosine (CAS: 14999-52-1)?

Disodium 2'-deoxy-5'-O-phosphonatoinosine is a white crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use Disodium 2'-deoxy-5'-O-phosphonatoinosine (CAS: 14999-52-1)?

Disodium 2'-deoxy-5'-O-phosphonatoinosine is primarily used in the pharmaceutical industry for the d...

Compound Q&A

What precautions should be taken when handling Disodium 2'-deoxy-5'-O-phosphonatoinosine (CAS: 14999-52-1)?

When handling Disodium 2'-deoxy-5'-O-phosphonatoinosine, it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...