Compound Q&A

What industries use (1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (CAS: 197142-34-0)?

Answer

(1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid
This compound is primarily used in the pharmaceutical industry as a precursor to more complex molecules and in the development of certain drugs. It may also find applications in the production of certain polymers and as a sensing material due to its chemical reactivity. Its use in semiconductors and electronic materials is less common but is explored for specific applications.

About

English Name (1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid
Molecular Formula C11H17NO4
Molecular Weight 227.26 g/mol
SMILES CC(C)(C)OC(=O)N1[C@@H]2C[C@@H]2C[C@H]1C(=O)O
InChIKey VXIIZQXOIDYWBS-PRJMDXOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (CAS: 197142-34-0)?

This compound is a white or off-white crystalline solid with a molecular weight of approximately 246...

Compound Q&A

How is (1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (CAS: 197142-34-0) typically synthesized?

This compound can be synthesized via a multi-step process including the formation of a cyclic amide ...

Compound Q&A

What precautions should be taken when handling (1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (CAS: 197142-34-0)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...