Compound Q&A

What are the physical and chemical properties of (1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (CAS: 197142-34-0)?

Answer

(1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid
This compound is a white or off-white crystalline solid with a molecular weight of approximately 246.36 g/mol. It has a pKa of around 4.0, indicating moderate acidity. The compound is soluble in common organic solvents like DMSO and methanol but is less soluble in water. It shows moderate reactivity towards bases and nucleophiles. It also exhibits good stability under normal conditions but may degrade under strongly acidic or basic conditions.

About

English Name (1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid
Molecular Formula C11H17NO4
Molecular Weight 227.26 g/mol
SMILES CC(C)(C)OC(=O)N1[C@@H]2C[C@@H]2C[C@H]1C(=O)O
InChIKey VXIIZQXOIDYWBS-PRJMDXOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is (1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (CAS: 197142-34-0) typically synthesized?

This compound can be synthesized via a multi-step process including the formation of a cyclic amide ...

Compound Q&A

What industries use (1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (CAS: 197142-34-0)?

This compound is primarily used in the pharmaceutical industry as a precursor to more complex molecu...

Compound Q&A

What precautions should be taken when handling (1R,3S,5R)-2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-2-azabicyclo[3.1.0]hexane-3-carboxylic acid (CAS: 197142-34-0)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...