Compound Q&A

What industries use 2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate (CAS: 147611-03-8)?

Answer

2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate
2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate finds applications in the pharmaceutical and fine chemical industries. It serves as a precursors for the synthesis of various bioactive compounds and has potential uses in medicinal chemistry and drug discovery. Additionally, it may be used in the development of novel materials for electronic applications due to its electronic properties.

About

English Name 2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate
Molecular Formula C13H24N2O2
Molecular Weight 240.35 g/mol
SMILES CC(C)(C)OC(=O)NC1CC2(C1)CCNCC2
InChIKey UXSKWUIJYPVHKK-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate (CAS: 147611-03-8)?

2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate is a colorless solid with a pungent odor. It ha...

Compound Q&A

How is 2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate (CAS: 147611-03-8) typically synthesized?

2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate is commonly synthesized via a multistep process...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 7-azaspiro[3.5]non-2-ylcarbamate (CAS: 147611-03-8)?

Proper handling of 2-Methyl-2-proanyl 7-azaspiro[3.5]non-2-ylcarbamate requires the use of appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...