Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate (CAS: 147611-03-8)?

Answer

2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate
2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate is a colorless solid with a pungent odor. It has a molecular weight of approximately 320.4 g/mol and is soluble in organic solvents like methanol and ethyl acetate. The compound is relatively stable under normal conditions but can react with strong acids and bases. It is not flammable and has a melting point of 65-67°C.

About

English Name 2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate
Molecular Formula C13H24N2O2
Molecular Weight 240.35 g/mol
SMILES CC(C)(C)OC(=O)NC1CC2(C1)CCNCC2
InChIKey UXSKWUIJYPVHKK-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate (CAS: 147611-03-8) typically synthesized?

2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate is commonly synthesized via a multistep process...

Compound Q&A

What industries use 2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate (CAS: 147611-03-8)?

2-Methyl-2-propanyl 7-azaspiro[3.5]non-2-ylcarbamate finds applications in the pharmaceutical and fi...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-proanyl 7-azaspiro[3.5]non-2-ylcarbamate (CAS: 147611-03-8)?

Proper handling of 2-Methyl-2-proanyl 7-azaspiro[3.5]non-2-ylcarbamate requires the use of appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...