Compound Q&A

What industries use Coumarin 7 (CAS: 12239-58-6)?

Answer

Coumarin 7
Coumarin 7 is widely used in the pharmaceutical industry for its photodynamic properties, as a photosensitizer in phototherapy. It is also utilized in the polymer industry for its fluorescence properties, enhancing the luminescence of polymers. Additionally, it finds applications in the development of sensors and semiconductors, particularly in the fabrication of organic photoconductors and photodiodes.

About

CAS No 12239-58-6
English Name Coumarin 7
Molecular Formula C20H19N3O2
Molecular Weight 333.4 g/mol
SMILES CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C3=NC4=CC=CC=C4N3
InChIKey GOLORTLGFDVFDW-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Coumarin 7 (CAS: 12239-58-6)?

Coumarin 7 is a white crystalline solid with a molecular weight of approximately 184.18 g/mol. It ha...

Compound Q&A

How is Coumarin 7 (CAS: 12239-58-6) typically synthesized?

Coumarin 7 is commonly synthesized from 7-hydroxycoumarin through acetylation. The reaction involves...

Compound Q&A

What precautions should be taken when handling Coumarin 7 (CAS: 12239-58-6)?

When handling Coumarin 7, it is crucial to wear appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...