Compound Q&A

What are the physical and chemical properties of Coumarin 7 (CAS: 12239-58-6)?

Answer

Coumarin 7
Coumarin 7 is a white crystalline solid with a molecular weight of approximately 184.18 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. Chemically, it is known for its photochemical properties, particularly its ability to undergo photoisomerization. Coumarin 7 is stable under normal conditions but can react with strong acids to form coumarin-3-carboxylic acid.

About

CAS No 12239-58-6
English Name Coumarin 7
Molecular Formula C20H19N3O2
Molecular Weight 333.4 g/mol
SMILES CCN(CC)C1=CC2=C(C=C1)C=C(C(=O)O2)C3=NC4=CC=CC=C4N3
InChIKey GOLORTLGFDVFDW-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is Coumarin 7 (CAS: 12239-58-6) typically synthesized?

Coumarin 7 is commonly synthesized from 7-hydroxycoumarin through acetylation. The reaction involves...

Compound Q&A

What industries use Coumarin 7 (CAS: 12239-58-6)?

Coumarin 7 is widely used in the pharmaceutical industry for its photodynamic properties, as a photo...

Compound Q&A

What precautions should be taken when handling Coumarin 7 (CAS: 12239-58-6)?

When handling Coumarin 7, it is crucial to wear appropriate personal protective equipment (PPE) such...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...