Compound Q&A

What precautions should be taken when handling 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7)?

Answer

5-fluoro-3-nitro-pyridin-2-amine
When handling 5-fluoro-3-nitro-pyridin-2-amine, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a fume hood to minimize exposure. Spills should be handled by neutralizing with an appropriate reagent before cleaning up. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name 5-fluoro-3-nitro-pyridin-2-amine
Molecular Formula C5H4FN3O2
Molecular Weight 157.1 g/mol
SMILES C1=C(C=NC(=C1[N+](=O)[O-])N)F
InChIKey LDYYBZNEWDTDEE-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7)?

5-Fluoro-3-nitro-pyridin-2-amine is a crystalline solid with a molecular weight of approximately 196...

Compound Q&A

How is 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7) typically synthesized?

5-Fluoro-3-nitro-pyridin-2-amine is typically synthesized via the amination of 5-fluoro-3-nitropyrid...

Compound Q&A

What industries use 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7)?

5-Fluoro-3-nitro-pyridin-2-amine is used in the pharmaceutical industry for the synthesis of certain...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...