Compound Q&A

How is 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7) typically synthesized?

Answer

5-fluoro-3-nitro-pyridin-2-amine
5-Fluoro-3-nitro-pyridin-2-amine is typically synthesized via the amination of 5-fluoro-3-nitropyridine with ammonia or an amine. The reaction is usually carried out in an aqueous medium with a catalyst such as sodium hydroxide. The yield is generally around 75-85%, with good selectivity towards the target amine.

About

English Name 5-fluoro-3-nitro-pyridin-2-amine
Molecular Formula C5H4FN3O2
Molecular Weight 157.1 g/mol
SMILES C1=C(C=NC(=C1[N+](=O)[O-])N)F
InChIKey LDYYBZNEWDTDEE-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7)?

5-Fluoro-3-nitro-pyridin-2-amine is a crystalline solid with a molecular weight of approximately 196...

Compound Q&A

What industries use 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7)?

5-Fluoro-3-nitro-pyridin-2-amine is used in the pharmaceutical industry for the synthesis of certain...

Compound Q&A

What precautions should be taken when handling 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7)?

When handling 5-fluoro-3-nitro-pyridin-2-amine, it is essential to use personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...