Compound Q&A

What industries use 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7)?

Answer

5-fluoro-3-nitro-pyridin-2-amine
5-Fluoro-3-nitro-pyridin-2-amine is used in the pharmaceutical industry for the synthesis of certain drugs. It can also be applied in the sensing technology for detecting specific chemical species. Its potential applications in semiconductors and polymers are also being explored due to its unique electronic properties.

About

English Name 5-fluoro-3-nitro-pyridin-2-amine
Molecular Formula C5H4FN3O2
Molecular Weight 157.1 g/mol
SMILES C1=C(C=NC(=C1[N+](=O)[O-])N)F
InChIKey LDYYBZNEWDTDEE-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7)?

5-Fluoro-3-nitro-pyridin-2-amine is a crystalline solid with a molecular weight of approximately 196...

Compound Q&A

How is 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7) typically synthesized?

5-Fluoro-3-nitro-pyridin-2-amine is typically synthesized via the amination of 5-fluoro-3-nitropyrid...

Compound Q&A

What precautions should be taken when handling 5-fluoro-3-nitro-pyridin-2-amine (CAS: 212268-12-7)?

When handling 5-fluoro-3-nitro-pyridin-2-amine, it is essential to use personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...