Compound Q&A

What industries use 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7)?

Answer

2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole
2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole is used in the pharmaceutical industry for the synthesis of certain drugs, particularly in the development of antimicrobial and antiviral agents. It is also utilized in the polymer industry as a stabilizer and in the electronics industry for corrosion inhibition. Additionally, it finds applications in the production of sensors and semiconductors.

About

English Name 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole
Molecular Formula C8H3ClF3NOS
Molecular Weight 253.63 g/mol
SMILES FC(F)(F)Oc1ccc2nc(Cl)sc2c1
InChIKey PPGSYGPSOLZOOU-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7)?

2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole is a solid, crystalline compound with a molecular we...

Compound Q&A

How is 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7) typically synthesized?

2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole is typically synthesized via electrophilic aromatic ...

Compound Q&A

What precautions should be taken when handling 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7)?

When handling 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole, ensure the use of proper personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...