Compound Q&A

How is 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7) typically synthesized?

Answer

2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole
2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole is typically synthesized via electrophilic aromatic substitution. The reaction involves the condensation of 2-chloro-3,5-difluorobenzoyl chloride with 1,3-benzothiazole in the presence of a catalyst like a Lewis acid. The reaction is carried out under anhydrous conditions to ensure high selectivity and yield.

About

English Name 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole
Molecular Formula C8H3ClF3NOS
Molecular Weight 253.63 g/mol
SMILES FC(F)(F)Oc1ccc2nc(Cl)sc2c1
InChIKey PPGSYGPSOLZOOU-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7)?

2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole is a solid, crystalline compound with a molecular we...

Compound Q&A

What industries use 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7)?

2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7)?

When handling 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole, ensure the use of proper personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...