Compound Q&A

What are the physical and chemical properties of 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7)?

Answer

2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole
2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole is a solid, crystalline compound with a molecular weight of approximately 308.02 g/mol. It has a low solubility in water but is soluble in organic solvents like ethanol and acetone. Chemically, it shows moderate reactivity towards nucleophiles and can undergo substitution reactions. The compound is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

English Name 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole
Molecular Formula C8H3ClF3NOS
Molecular Weight 253.63 g/mol
SMILES FC(F)(F)Oc1ccc2nc(Cl)sc2c1
InChIKey PPGSYGPSOLZOOU-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7) typically synthesized?

2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole is typically synthesized via electrophilic aromatic ...

Compound Q&A

What industries use 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7)?

2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole (CAS: 133840-96-7)?

When handling 2-Chloro-6-(trifluoromethoxy)-1,3-benzothiazole, ensure the use of proper personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...