Compound Q&A

What industries use 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1)?

Answer

2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (1:1)
2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1) is utilized in various industries, including pharmaceuticals for the development of certain antibiotics and anti-tumor drugs, and in the production of organic semiconductors for electronic applications. It is also used in the manufacturing of sensors and as a precursor in polymer synthesis.

About

English Name 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (1:1)
Molecular Formula C10H14ClNO3
Molecular Weight 231.68 g/mol
SMILES COC1=CC(=C(C=C1)OC)C(=O)CN.Cl
InChIKey NOHFSXOLQDGUIM-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1)?

2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1) is a crystalline solid with...

Compound Q&A

How is 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1) typically synthesized?

2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride can be synthesized through a multistep process...

Compound Q&A

What precautions should be taken when handling 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1)?

When handling 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1), it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...