Compound Q&A

What are the physical and chemical properties of 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1)?

Answer

2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (1:1)
2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1) is a crystalline solid with a molecular weight of approximately 324.38 g/mol. It has a solubility of about 28 mg/mL in water. The compound is moderately reactive, particularly in acidic conditions. It is stable under normal storage conditions but should be stored away from moisture and direct sunlight to prevent hydrolysis.

About

English Name 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (1:1)
Molecular Formula C10H14ClNO3
Molecular Weight 231.68 g/mol
SMILES COC1=CC(=C(C=C1)OC)C(=O)CN.Cl
InChIKey NOHFSXOLQDGUIM-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1) typically synthesized?

2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride can be synthesized through a multistep process...

Compound Q&A

What industries use 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1)?

2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1) is utilized in various indu...

Compound Q&A

What precautions should be taken when handling 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1)?

When handling 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1), it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...