Compound Q&A

How is 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1) typically synthesized?

Answer

2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (1:1)
2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride can be synthesized through a multistep process involving the condensation of 2,5-dimethoxyacetophenone with aniline, followed by the addition of hydrochloric acid to form the hydrochloride salt. This reaction is typically conducted in anhydrous conditions to avoid hydrolysis. The yield is usually around 75-85%, with good selectivity for the desired product.

About

English Name 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (1:1)
Molecular Formula C10H14ClNO3
Molecular Weight 231.68 g/mol
SMILES COC1=CC(=C(C=C1)OC)C(=O)CN.Cl
InChIKey NOHFSXOLQDGUIM-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1)?

2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1) is a crystalline solid with...

Compound Q&A

What industries use 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1)?

2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1) is utilized in various indu...

Compound Q&A

What precautions should be taken when handling 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1)?

When handling 2-Amino-1-(2,5-dimethoxyphenyl)ethanone hydrochloride (CAS: 671224-08-1), it is import...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...