Compound Q&A

What are the physical and chemical properties of GLP-1 moiety from Dulaglutide (CAS: 923950-08-7)?

Answer

GLP-1 moiety from Dulaglutide
GLP-1 moiety from Dulaglutide (CAS: 923950-08-7) is a crystalline compound with a molecular weight of approximately 1290 Da. It is poorly soluble in water but more soluble in organic solvents like DMSO. The compound exhibits moderate reactivity, particularly with nucleophiles and bases, making it susceptible to hydrolysis under alkaline conditions. Care should be taken to store and handle it under basic storage conditions to minimize degradation.

About

English Name GLP-1 moiety from Dulaglutide
Molecular Formula C19H15N3O3
Molecular Weight 333.35 g/mol
SMILES CCC(C)C(C(=O)NC(C)C(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)NC(CC(C)C)C(=O)NC(C(C)C)C(=O)NC(CCCCN)C(=O)NCC(=O)NCC(=O)NCC(=O)O)NC(=O)C(CC3=CC=CC=C3)NC(=O)C(CCC(=O)O)NC(=O)C(CCCCN)NC(=O)C(C)NC(=O)C(C)NC(=O)C(CCC(=O)N)NC(=O)C(CCC(=O)O)NC(=O)C(CCC(=O)O)NC(=O)C(CC(C)C)NC(=O)C(CC4=CC=C(C=C4)O)NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(C(C)C)NC(=O)C(CC(=O)O)NC(=O)C(CO)NC(=O)C(C(C)O)NC(=O)C(CC5=CC=CC=C5)NC(=O)C(C(C)O)NC(=O)CNC(=O)C(CCC(=O)O)NC(=O)CNC(=O)C(CC6=CNC=N6)N
InChIKey UENSIXLPLYMXMK-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is the GLP-1 moiety from Dulaglutide (CAS: 923950-08-7) typically synthesized?

The GLP-1 moiety from Dulaglutide (CAS: 923950-08-7) is typically synthesized through solid-phase pe...

Compound Q&A

What industries use GLP-1 moiety from Dulaglutide (CAS: 923950-08-7)?

GLP-1 moiety from Dulaglutide (CAS: 923950-08-7) is primarily used in the pharmaceutical industry, p...

Compound Q&A

What precautions should be taken when handling GLP-1 moiety from Dulaglutide (CAS: 923950-08-7)?

When handling GLP-1 moiety from Dulaglutide (CAS: 923950-08-7), proper personal protective equipment...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...