Compound Q&A

What precautions should be taken when handling Trimethylsulfonium methyl sulfate (CAS: 2181-44-4)?

Answer

Trimethylsulfonium methyl sulfate
When handling Trimethylsulfonium methyl sulfate (CAS: 2181-44-4), it is crucial to use personal protective equipment (PPE) such as gloves and safety goggles. Work should be conducted in a well-ventilated area or a fume hood to minimize exposure. Spills should be promptly cleaned up and disposed of according to safety data sheet (SDS) guidelines. Always consult an SDS for detailed handling and disposal instructions.

About

CAS No 2181-44-4
English Name Trimethylsulfonium methyl sulfate
Molecular Formula C4H12O4S2
Molecular Weight 188.3 g/mol
SMILES COS(=O)(=O)[O-].C[S+](C)C
InChIKey ANXKZXRDXAZQJT-UHFFFAOYSA-M
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Trimethylsulfonium methyl sulfate (CAS: 2181-44-4)?

Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) is a crystalline compound with a molecular weight...

Compound Q&A

How is Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) typically synthesized?

Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) is usually synthesized through the reaction of di...

Compound Q&A

What industries use Trimethylsulfonium methyl sulfate (CAS: 2181-44-4)?

Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) is utilized in the pharmaceutical and polymer ind...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...