Compound Q&A

What industries use Trimethylsulfonium methyl sulfate (CAS: 2181-44-4)?

Answer

Trimethylsulfonium methyl sulfate
Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) is utilized in the pharmaceutical and polymer industries for its unique reactivity and solubility properties. It also finds applications in the development of sensors and semiconductors due to its Lewis acidic nature and ability to participate in various chemical reactions.

About

CAS No 2181-44-4
English Name Trimethylsulfonium methyl sulfate
Molecular Formula C4H12O4S2
Molecular Weight 188.3 g/mol
SMILES COS(=O)(=O)[O-].C[S+](C)C
InChIKey ANXKZXRDXAZQJT-UHFFFAOYSA-M
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Trimethylsulfonium methyl sulfate (CAS: 2181-44-4)?

Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) is a crystalline compound with a molecular weight...

Compound Q&A

How is Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) typically synthesized?

Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) is usually synthesized through the reaction of di...

Compound Q&A

What precautions should be taken when handling Trimethylsulfonium methyl sulfate (CAS: 2181-44-4)?

When handling Trimethylsulfonium methyl sulfate (CAS: 2181-44-4), it is crucial to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...