Compound Q&A

What are the physical and chemical properties of Trimethylsulfonium methyl sulfate (CAS: 2181-44-4)?

Answer

Trimethylsulfonium methyl sulfate
Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) is a crystalline compound with a molecular weight of approximately 168.24 g/mol. It has good solubility in polar solvents such as water and ethanol. Chemically, it is highly reactive, particularly in acidic conditions, and can act as a Lewis acid, facilitating various chemical transformations.

About

CAS No 2181-44-4
English Name Trimethylsulfonium methyl sulfate
Molecular Formula C4H12O4S2
Molecular Weight 188.3 g/mol
SMILES COS(=O)(=O)[O-].C[S+](C)C
InChIKey ANXKZXRDXAZQJT-UHFFFAOYSA-M
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) typically synthesized?

Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) is usually synthesized through the reaction of di...

Compound Q&A

What industries use Trimethylsulfonium methyl sulfate (CAS: 2181-44-4)?

Trimethylsulfonium methyl sulfate (CAS: 2181-44-4) is utilized in the pharmaceutical and polymer ind...

Compound Q&A

What precautions should be taken when handling Trimethylsulfonium methyl sulfate (CAS: 2181-44-4)?

When handling Trimethylsulfonium methyl sulfate (CAS: 2181-44-4), it is crucial to use personal prot...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...