Compound Q&A

How is 9H-Fluoren-9-ylacetic acid (CAS: 6284-80-6) typically synthesized?

Answer

9H-Fluoren-9-ylacetic acid
9H-Fluoren-9-ylacetic acid is typically synthesized by esterification of fluorene-9-carboxylic acid chloride with methanol in the presence of an acid catalyst, such as sulfuric acid. The yield can reach up to 90%, and the reaction is carried out at room temperature. Selectivity is good, with high purity product obtained via recrystallization.

About

CAS No 6284-80-6
English Name 9H-Fluoren-9-ylacetic acid
Molecular Formula C15H12O2
Molecular Weight 224.26 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)CC(=O)O
InChIKey WFSMJMTYIMFHPV-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 9H-Fluoren-9-ylacetic acid (CAS: 6284-80-6)?

9H-Fluoren-9-ylacetic acid is a white to off-white crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use 9H-Fluoren-9-ylacetic acid (CAS: 6284-80-6)?

9H-Fluoren-9-ylacetic acid is used in the pharmaceutical industry for synthesis of certain drugs, in...

Compound Q&A

What precautions should be taken when handling 9H-Fluoren-9-ylacetic acid (CAS: 6284-80-6)?

When handling 9H-Fluoren-9-ylacetic acid, wear appropriate personal protective equipment (PPE) such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...