Compound Q&A

What are the physical and chemical properties of 9H-Fluoren-9-ylacetic acid (CAS: 6284-80-6)?

Answer

9H-Fluoren-9-ylacetic acid
9H-Fluoren-9-ylacetic acid is a white to off-white crystalline solid with a molecular weight of approximately 198.23 g/mol. It is sparingly soluble in water but soluble in common organic solvents such as ethanol and acetone. It exhibits moderate reactivity, primarily undergoing esterification and ester hydrolysis reactions. Its density is around 1.27 g/cm³ and melting point is approximately 138-139°C.

About

CAS No 6284-80-6
English Name 9H-Fluoren-9-ylacetic acid
Molecular Formula C15H12O2
Molecular Weight 224.26 g/mol
SMILES C1=CC=C2C(=C1)C(C3=CC=CC=C32)CC(=O)O
InChIKey WFSMJMTYIMFHPV-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 9H-Fluoren-9-ylacetic acid (CAS: 6284-80-6) typically synthesized?

9H-Fluoren-9-ylacetic acid is typically synthesized by esterification of fluorene-9-carboxylic acid ...

Compound Q&A

What industries use 9H-Fluoren-9-ylacetic acid (CAS: 6284-80-6)?

9H-Fluoren-9-ylacetic acid is used in the pharmaceutical industry for synthesis of certain drugs, in...

Compound Q&A

What precautions should be taken when handling 9H-Fluoren-9-ylacetic acid (CAS: 6284-80-6)?

When handling 9H-Fluoren-9-ylacetic acid, wear appropriate personal protective equipment (PPE) such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...