Compound Q&A

What industries use 4-Bromo-3,5-difluorobenzoic acid (CAS: 651027-00-8)?

Answer

4-Bromo-3,5-difluorobenzoic acid
4-Bromo-3,5-difluorobenzoic acid is used in various industries, including pharmaceuticals for the synthesis of certain drugs, and in the production of organic semiconductors and sensors. It is also utilized in the preparation of polymers with specific electronic properties.

About

English Name 4-Bromo-3,5-difluorobenzoic acid
Molecular Formula C7H3BrF2O2
Molecular Weight 237 g/mol
SMILES C1=C(C=C(C(=C1F)Br)F)C(=O)O
InChIKey NLLRAEQVOZOSBB-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-3,5-difluorobenzoic acid (CAS: 651027-00-8)?

4-Bromo-3,5-difluorobenzoic acid is a white crystalline solid with a molecular weight of 255.03 g/mo...

Compound Q&A

How is 4-Bromo-3,5-difluorobenzoic acid (CAS: 651027-00-8) typically synthesized?

4-Bromo-3,5-difluorobenzoic acid is typically synthesized through a two-step process: first, 3,5-dif...

Compound Q&A

What precautions should be taken when handling 4-Bromo-3,5-difluorobenzoic acid (CAS: 651027-00-8)?

Proper handling of 4-Bromo-3,5-difluorobenzoic acid requires the use of chemical protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...