Compound Q&A

How is 4-Bromo-3,5-difluorobenzoic acid (CAS: 651027-00-8) typically synthesized?

Answer

4-Bromo-3,5-difluorobenzoic acid
4-Bromo-3,5-difluorobenzoic acid is typically synthesized through a two-step process: first, 3,5-difluorobenzoic acid is brominated, and then the resulting bromide is converted to the carboxylic acid. Common reagents include bromine and a Lewis acid catalyst like aluminum bromide.

About

English Name 4-Bromo-3,5-difluorobenzoic acid
Molecular Formula C7H3BrF2O2
Molecular Weight 237 g/mol
SMILES C1=C(C=C(C(=C1F)Br)F)C(=O)O
InChIKey NLLRAEQVOZOSBB-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-3,5-difluorobenzoic acid (CAS: 651027-00-8)?

4-Bromo-3,5-difluorobenzoic acid is a white crystalline solid with a molecular weight of 255.03 g/mo...

Compound Q&A

What industries use 4-Bromo-3,5-difluorobenzoic acid (CAS: 651027-00-8)?

4-Bromo-3,5-difluorobenzoic acid is used in various industries, including pharmaceuticals for the sy...

Compound Q&A

What precautions should be taken when handling 4-Bromo-3,5-difluorobenzoic acid (CAS: 651027-00-8)?

Proper handling of 4-Bromo-3,5-difluorobenzoic acid requires the use of chemical protective equipmen...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...