Compound Q&A

What precautions should be taken when handling 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7)?

Answer

2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid
When handling 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7), appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. The compound should be handled in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbents, and proper disposal should follow local regulations. Refer to the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 5001-96-7
English Name 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid
Molecular Formula C14H11FO2
Molecular Weight 230.24 g/mol
SMILES C1=CC=C(C=C1)C2=C(C=C(C=C2)CC(=O)O)F
InChIKey ZLLZRKQQNGBXRD-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7)?

2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) is a crystalline solid with a molecula...

Compound Q&A

How is 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) typically synthesized?

2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) can be synthesized via a multi-step pr...

Compound Q&A

What industries use 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7)?

2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) is primarily used in the pharmaceutica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...