Compound Q&A

What are the physical and chemical properties of 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7)?

Answer

2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid
2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) is a crystalline solid with a molecular weight of approximately 313.21 g/mol. It has a low water solubility and limited reactivity under normal conditions. The compound is stable towards hydrolysis and oxidation, but care should be taken in acidic or basic environments. It is soluble in common organic solvents such as ethanol and dichloromethane.

About

CAS No 5001-96-7
English Name 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid
Molecular Formula C14H11FO2
Molecular Weight 230.24 g/mol
SMILES C1=CC=C(C=C1)C2=C(C=C(C=C2)CC(=O)O)F
InChIKey ZLLZRKQQNGBXRD-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

How is 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) typically synthesized?

2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) can be synthesized via a multi-step pr...

Compound Q&A

What industries use 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7)?

2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7)?

When handling 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7), appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...