Compound Q&A

How is 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) typically synthesized?

Answer

2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid
2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) can be synthesized via a multi-step process starting from 4-fluoro-[1,1'-biphenyl] and acetic anhydride. The key steps involve coupling reactions, acetylation, and purification. Common catalysts include triphenylphosphine. The overall yield is moderate, around 60-70%, with high chemical selectivity.

About

CAS No 5001-96-7
English Name 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid
Molecular Formula C14H11FO2
Molecular Weight 230.24 g/mol
SMILES C1=CC=C(C=C1)C2=C(C=C(C=C2)CC(=O)O)F
InChIKey ZLLZRKQQNGBXRD-UHFFFAOYSA-N
Last Updated: 2025-10-23 07:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7)?

2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) is a crystalline solid with a molecula...

Compound Q&A

What industries use 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7)?

2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7)?

When handling 2-(2-Fluoro-[1,1'-biphenyl]-4-yl)acetic acid (CAS: 5001-96-7), appropriate personal pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...