Compound Q&A

What industries use 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1)?

Answer

1,3-dichloro-2-methyl-5-nitro-benzene
1,3-Dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) is primarily used in the pharmaceutical industry for the production of certain drugs. It also has applications in the manufacturing of dyes and pigments, as well as in the synthesis of other organic compounds. Additionally, it can be used in the preparation of electronic materials and sensors.

About

CAS No 7149-69-1
English Name 1,3-dichloro-2-methyl-5-nitro-benzene
Molecular Formula C7H5Cl2NO2
Molecular Weight 206.02 g/mol
SMILES CC1=C(C=C(C=C1Cl)[N+](=O)[O-])Cl
InChIKey RUVCGWLHTVGNGI-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1)?

1,3-Dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) is a solid at room temperature, with a molecu...

Compound Q&A

How is 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) typically synthesized?

1,3-Dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) is typically synthesized via the nitration of...

Compound Q&A

What precautions should be taken when handling 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1)?

When handling 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1), it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...