Compound Q&A

How is 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) typically synthesized?

Answer

1,3-dichloro-2-methyl-5-nitro-benzene
1,3-Dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) is typically synthesized via the nitration of 1,3-dichloro-2-methylbenzene followed by the chlorination of the nitro derivative. The synthesis involves the use of concentrated nitric and sulfuric acids as reagents. The process requires precise control of temperature and reaction time to achieve high yield and selectivity.

About

CAS No 7149-69-1
English Name 1,3-dichloro-2-methyl-5-nitro-benzene
Molecular Formula C7H5Cl2NO2
Molecular Weight 206.02 g/mol
SMILES CC1=C(C=C(C=C1Cl)[N+](=O)[O-])Cl
InChIKey RUVCGWLHTVGNGI-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1)?

1,3-Dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) is a solid at room temperature, with a molecu...

Compound Q&A

What industries use 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1)?

1,3-Dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1)?

When handling 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1), it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...