Compound Q&A

What are the physical and chemical properties of 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1)?

Answer

1,3-dichloro-2-methyl-5-nitro-benzene
1,3-Dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) is a solid at room temperature, with a molecular weight of 249.03 g/mol. It has a melting point of 106-108°C and a density of 1.49 g/cm³. It is moderately soluble in water but highly soluble in organic solvents like ethanol and methanol. The compound is an electrophilic aromatic compound and can react with nucleophiles to form substitution products.

About

CAS No 7149-69-1
English Name 1,3-dichloro-2-methyl-5-nitro-benzene
Molecular Formula C7H5Cl2NO2
Molecular Weight 206.02 g/mol
SMILES CC1=C(C=C(C=C1Cl)[N+](=O)[O-])Cl
InChIKey RUVCGWLHTVGNGI-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) typically synthesized?

1,3-Dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) is typically synthesized via the nitration of...

Compound Q&A

What industries use 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1)?

1,3-Dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1) is primarily used in the pharmaceutical indus...

Compound Q&A

What precautions should be taken when handling 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1)?

When handling 1,3-dichloro-2-methyl-5-nitro-benzene (CAS: 7149-69-1), it is essential to wear approp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...