Compound Q&A

What industries use 2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-isoindolinecarboxylic acid (CAS: 221352-46-1)?

Answer

2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-isoindolinecarboxylic acid
2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-isoindolinecarboxylic acid is used in the pharmaceutical industry for the development of certain drug candidates. It also finds applications in the production of certain polymers and as a chemical intermediate in organic synthesis. Additionally, it is used in the synthesis of materials for sensors and semiconductors, though its specific roles in these industries are limited.

About

English Name 2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-isoindolinecarboxylic acid
Molecular Formula C14H17NO4
Molecular Weight 263.29 g/mol
SMILES CC(C)(C)OC(=O)N1CC2=CC=CC=C2C1C(=O)O
InChIKey BBMCBMREDOQCDU-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-isoindolinecarboxylic acid (CAS: 221352-46-1)?

2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-isoindolinecarboxylic acid is a white crystalline solid wit...

Compound Q&A

How is 2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-isoindolinecarboxylic acid (CAS: 221352-46-1) typically synthesized?

2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-isoindolinecarboxylic acid can be synthesized via a multi-s...

Compound Q&A

What precautions should be taken when handling 2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-isoindolinecarboxylic acid (CAS: 221352-46-1)?

When handling 2-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-isoindolinecarboxylic acid, it is essential t...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...