Compound Q&A

What industries use 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2)?

Answer

5-Phenyl-1H-pyrazole-3-carboxylic acid
5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2) is used in the pharmaceutical industry for the synthesis of certain drugs. It also finds applications in the polymer industry for modifying the properties of polymers, in sensor technology for detecting specific analytes, and in semiconductor manufacturing as a component in certain solutions.

About

CAS No 1134-49-2
English Name 5-Phenyl-1H-pyrazole-3-carboxylic acid
Molecular Formula C10H8N2O2
Molecular Weight 188.19 g/mol
SMILES C1=CC=C(C=C1)C2=NNC(=C2)C(=O)O
InChIKey QBPUOAJBMXXBNU-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2)?

5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2) is a crystalline solid with a molecular weig...

Compound Q&A

How is 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2) typically synthesized?

5-Phenyl-1H-pyrazole-3-carboxylic acid is typically synthesized via the condensation of phenyl isocy...

Compound Q&A

What precautions should be taken when handling 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2)?

When handling 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2), wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...