Compound Q&A

How is 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2) typically synthesized?

Answer

5-Phenyl-1H-pyrazole-3-carboxylic acid
5-Phenyl-1H-pyrazole-3-carboxylic acid is typically synthesized via the condensation of phenyl isocyanate and 1,3-dicarbonyl compounds. The reaction is catalyzed by acids and proceeds with good yield. The product can be purified by recrystallization from appropriate solvents.

About

CAS No 1134-49-2
English Name 5-Phenyl-1H-pyrazole-3-carboxylic acid
Molecular Formula C10H8N2O2
Molecular Weight 188.19 g/mol
SMILES C1=CC=C(C=C1)C2=NNC(=C2)C(=O)O
InChIKey QBPUOAJBMXXBNU-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2)?

5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2) is a crystalline solid with a molecular weig...

Compound Q&A

What industries use 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2)?

5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2) is used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2)?

When handling 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2), wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...