Compound Q&A

What are the physical and chemical properties of 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2)?

Answer

5-Phenyl-1H-pyrazole-3-carboxylic acid
5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2) is a crystalline solid with a molecular weight of approximately 182.19 g/mol. It has a pKa of 4.6, indicating acidic properties. The compound is slightly soluble in water but soluble in common organic solvents like ethanol and acetone. It is reactive towards bases and can form salts.

About

CAS No 1134-49-2
English Name 5-Phenyl-1H-pyrazole-3-carboxylic acid
Molecular Formula C10H8N2O2
Molecular Weight 188.19 g/mol
SMILES C1=CC=C(C=C1)C2=NNC(=C2)C(=O)O
InChIKey QBPUOAJBMXXBNU-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2) typically synthesized?

5-Phenyl-1H-pyrazole-3-carboxylic acid is typically synthesized via the condensation of phenyl isocy...

Compound Q&A

What industries use 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2)?

5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2) is used in the pharmaceutical industry for t...

Compound Q&A

What precautions should be taken when handling 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2)?

When handling 5-Phenyl-1H-pyrazole-3-carboxylic acid (CAS: 1134-49-2), wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...