Compound Q&A

What industries use Norgestimate (CAS: 35189-28-7)?

Answer

Norgestimate
Norgestimate (CAS: 35189-28-7) is primarily used in the pharmaceutical industry, particularly in hormonal contraceptives. It is also utilized in some diagnostic and therapeutic applications. The compound is less common in other industries such as polymers or sensors but may have niche applications in areas requiring specific hormonal properties.

About

CAS No 35189-28-7
English Name Norgestimate
Molecular Formula C23H31NO3
Molecular Weight 369.5 g/mol
SMILES O/N=C/1\CC[C@H]2C(=C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@]2(C#C)OC(=O)C)CC
InChIKey KIQQMECNKUGGKA-NMYWJIRASA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of Norgestimate (CAS: 35189-28-7)?

Norgestimate (CAS: 35189-28-7) is a crystalline white to off-white powder. Its molecular weight is a...

Compound Q&A

How is Norgestimate (CAS: 35189-28-7) typically synthesized?

Norgestimate (CAS: 35189-28-7) is typically synthesized via a multi-step process starting from proge...

Compound Q&A

What precautions should be taken when handling Norgestimate (CAS: 35189-28-7)?

When handling Norgestimate (CAS: 35189-28-7), it is essential to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...