Compound Q&A

What are the physical and chemical properties of Norgestimate (CAS: 35189-28-7)?

Answer

Norgestimate
Norgestimate (CAS: 35189-28-7) is a crystalline white to off-white powder. Its molecular weight is approximately 362.49 g/mol. Norgestimate is slightly soluble in water and has good solubility in organic solvents like ethanol and acetone. It is stable under normal conditions but should be protected from moisture. Norgestimate shows moderate reactivity towards bases and is sensitive to strong acids, making it susceptible to hydrolysis under acidic conditions.

About

CAS No 35189-28-7
English Name Norgestimate
Molecular Formula C23H31NO3
Molecular Weight 369.5 g/mol
SMILES O/N=C/1\CC[C@H]2C(=C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@]2(C#C)OC(=O)C)CC
InChIKey KIQQMECNKUGGKA-NMYWJIRASA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is Norgestimate (CAS: 35189-28-7) typically synthesized?

Norgestimate (CAS: 35189-28-7) is typically synthesized via a multi-step process starting from proge...

Compound Q&A

What industries use Norgestimate (CAS: 35189-28-7)?

Norgestimate (CAS: 35189-28-7) is primarily used in the pharmaceutical industry, particularly in hor...

Compound Q&A

What precautions should be taken when handling Norgestimate (CAS: 35189-28-7)?

When handling Norgestimate (CAS: 35189-28-7), it is essential to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...