Compound Q&A

How is Norgestimate (CAS: 35189-28-7) typically synthesized?

Answer

Norgestimate
Norgestimate (CAS: 35189-28-7) is typically synthesized via a multi-step process starting from progesterone. The key steps include acetylation, oxidation, and reduction. The reaction involves the use of acetic anhydride for acetylation, followed by catalytic oxidation with chromic acid. The reduction step often uses sodium borohydride. The overall process yields Norgestimate with good selectivity, and the final product is purified by recrystallization and chromatography techniques.

About

CAS No 35189-28-7
English Name Norgestimate
Molecular Formula C23H31NO3
Molecular Weight 369.5 g/mol
SMILES O/N=C/1\CC[C@H]2C(=C1)CC[C@@H]1[C@@H]2CC[C@]2([C@H]1CC[C@]2(C#C)OC(=O)C)CC
InChIKey KIQQMECNKUGGKA-NMYWJIRASA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of Norgestimate (CAS: 35189-28-7)?

Norgestimate (CAS: 35189-28-7) is a crystalline white to off-white powder. Its molecular weight is a...

Compound Q&A

What industries use Norgestimate (CAS: 35189-28-7)?

Norgestimate (CAS: 35189-28-7) is primarily used in the pharmaceutical industry, particularly in hor...

Compound Q&A

What precautions should be taken when handling Norgestimate (CAS: 35189-28-7)?

When handling Norgestimate (CAS: 35189-28-7), it is essential to use personal protective equipment (...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...