Compound Q&A

What industries use Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4)?

Answer

[1]Benzothieno[3,2-b][1]benzothiophene
Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) is used in various industries, including pharmaceuticals for the development of certain drugs, polymers for manufacturing advanced materials, sensors for detecting gases, and semiconductors for electronic applications. Its unique structure makes it valuable for these applications due to its electronic and chemical properties.

About

CAS No 248-70-4
English Name [1]Benzothieno[3,2-b][1]benzothiophene
Molecular Formula C14H8S2
Molecular Weight 240.35 g/mol
SMILES C1=CC=C2C(=C1)C3=C(S2)C4=CC=CC=C4S3
InChIKey NXCSDJOTXUWERI-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4)?

Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) is a crystalline compound with a molecular weigh...

Compound Q&A

How is Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) typically synthesized?

Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) is typically synthesized via a two-step process ...

Compound Q&A

What precautions should be taken when handling Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4)?

When handling Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...