Compound Q&A

What are the physical and chemical properties of Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4)?

Answer

[1]Benzothieno[3,2-b][1]benzothiophene
Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) is a crystalline compound with a molecular weight of approximately 213.24 g/mol. It has a low solubility in water but is soluble in organic solvents like dichloromethane and acetone. It is less reactive compared to other sulfur-containing compounds but can undergo substitution reactions under certain conditions. The compound is stable under normal conditions but should be handled with care due to the potential for decomposition at high temperatures.

About

CAS No 248-70-4
English Name [1]Benzothieno[3,2-b][1]benzothiophene
Molecular Formula C14H8S2
Molecular Weight 240.35 g/mol
SMILES C1=CC=C2C(=C1)C3=C(S2)C4=CC=CC=C4S3
InChIKey NXCSDJOTXUWERI-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

How is Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) typically synthesized?

Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) is typically synthesized via a two-step process ...

Compound Q&A

What industries use Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4)?

Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) is used in various industries, including pharmac...

Compound Q&A

What precautions should be taken when handling Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4)?

When handling Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...