Compound Q&A

How is Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) typically synthesized?

Answer

[1]Benzothieno[3,2-b][1]benzothiophene
Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) is typically synthesized via a two-step process involving the reaction of benzothiophene with a brominating agent followed by a nucleophilic substitution reaction. The key steps involve the formation of a brominated intermediate and subsequent reaction with a butadienyl derivative or similar nucleophile. The yield and selectivity of the reaction can be enhanced through the use of appropriate catalysts and solvents.

About

CAS No 248-70-4
English Name [1]Benzothieno[3,2-b][1]benzothiophene
Molecular Formula C14H8S2
Molecular Weight 240.35 g/mol
SMILES C1=CC=C2C(=C1)C3=C(S2)C4=CC=CC=C4S3
InChIKey NXCSDJOTXUWERI-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4)?

Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) is a crystalline compound with a molecular weigh...

Compound Q&A

What industries use Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4)?

Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4) is used in various industries, including pharmac...

Compound Q&A

What precautions should be taken when handling Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4)?

When handling Benzothieno[3,2-b][1]benzothiophene (CAS: 248-70-4), it is essential to use appropriat...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...