Compound Q&A

How is tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9) typically synthesized?

Answer

tert-Butyl (5-bromothiophen-2-yl)carbamate
Tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9) can be synthesized via a multi-step process. A common method involves the reaction of tert-butyl carbamate with 2-bromothiophene under basic conditions. The reaction typically proceeds with a yield of around 75-80% and requires careful control of reaction conditions to ensure selectivity and high purity of the product.

About

English Name tert-Butyl (5-bromothiophen-2-yl)carbamate
Molecular Formula C9H12BrNO2S
Molecular Weight 278.17 g/mol
SMILES CC(C)(C)OC(=O)NC1=CC=C(S1)Br
InChIKey SKPRAKMCHAPMNY-UHFFFAOYSA-N
Last Updated: 2025-10-22 19:24

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9)?

Tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9) is a white to off-white crystalline so...

Compound Q&A

What industries use tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9)?

Tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9) is primarily used in pharmaceutical an...

Compound Q&A

What precautions should be taken when handling tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9)?

When handling tert-Butyl (5-bromothiophen-2-yl)carbamate (CAS: 943321-89-9), it is crucial to use ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...